C18H16BrClN4 — CID 141220298
4-bromo-3-(2-chloro-4-pyridinyl)-1-piperidin-1-yl-2,6-naphthyridine (PubChem CID 141220298) has the molecular formula C18H16BrClN4 and a molecular weight of 403.71 g/mol. Its IUPAC name is 4-bromo-3-(2-chloro-4-pyridinyl)-1-piperidin-1-yl-2,6-naphthyridine.
| Compound Name | 4-bromo-3-(2-chloro-4-pyridinyl)-1-piperidin-1-yl-2,6-naphthyridine |
|---|---|
| PubChem CID | 141220298 |
| Molecular Formula | C18H16BrClN4 |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 4-bromo-3-(2-chloro-4-pyridinyl)-1-piperidin-1-yl-2,6-naphthyridine |
| SMILES | Clc1cc(-c2nc(N3CCCCC3)c3ccncc3c2Br)ccn1 |
| InChI | InChI=1S/C18H16BrClN4/c19-16-14-11-21-6-5-13(14)18(24-8-2-1-3-9-24)23-17(16)12-4-7-22-15(20)10-12/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | QLTYRVSNJJARHK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|