C7H9N5OS — CID 141220420
2-[2-(1,2,4-triazol-1-yl)ethylimino]-1,3-thiazolidin-4-one (PubChem CID 141220420) has the molecular formula C7H9N5OS and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-[2-(1,2,4-triazol-1-yl)ethylimino]-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-(1,2,4-triazol-1-yl)ethylimino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 141220420 |
| Molecular Formula | C7H9N5OS |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-[2-(1,2,4-triazol-1-yl)ethylimino]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\CCn2cncn2)N1 |
| InChI | InChI=1S/C7H9N5OS/c13-6-3-14-7(11-6)9-1-2-12-5-8-4-10-12/h4-5H,1-3H2,(H,9,11,13) |
| InChIKey | KYTNTVAJBDXWJK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|