About tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate
tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate (PubChem CID 141220555) has the molecular formula C13H14BrF4NO2
and a molecular weight of 372.16 g/mol. Its IUPAC name is tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate |
| PubChem CID | 141220555 |
| Molecular Formula | C13H14BrF4NO2 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccc(F)cc1Br)C(F)(F)F |
| InChI | InChI=1S/C13H14BrF4NO2/c1-12(2,3)21-11(20)19-10(13(16,17)18)8-5-4-7(15)6-9(8)14/h4-6,10H,1-3H3,(H,19,20) |
| InChIKey | LOFHGCXIOSLAIT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate?
The IUPAC name of tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate (CID 141220555) is tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate?
The canonical SMILES for tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate is CC(C)(C)OC(=O)NC(c1ccc(F)cc1Br)C(F)(F)F.
What is the InChIKey of tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate?
The InChIKey is LOFHGCXIOSLAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrF4NO2/c1-12(2,3)21-11(20)19-10(13(16,17)18)8-5-4-7(15)6-9(8)14/h4-6,10H,1-3H3,(H,19,20).
What are the key properties of tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate?
tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate has a molecular weight of 372.16 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamate is sourced from PubChem (CID 141220555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).