C10H17N3S — CID 141220598
1-propyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)hydrazine (PubChem CID 141220598) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 1-propyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)hydrazine.
| Compound Name | 1-propyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)hydrazine |
|---|---|
| PubChem CID | 141220598 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-propyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)hydrazine |
| SMILES | CCCN(N)C1CCc2ncsc2C1 |
| InChI | InChI=1S/C10H17N3S/c1-2-5-13(11)8-3-4-9-10(6-8)14-7-12-9/h7-8H,2-6,11H2,1H3 |
| InChIKey | ZLGOAIFIUBQTEU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|