About 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione
1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione (PubChem CID 141220681) has the molecular formula C26H21Cl2NO2
and a molecular weight of 450.37 g/mol. Its IUPAC name is 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione.
Molecular Properties
| Compound Name | 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione |
| PubChem CID | 141220681 |
| Molecular Formula | C26H21Cl2NO2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione |
| SMILES | Cc1cccc(C2CC(=O)CC(c3cccc(Cl)c3)C23C(=O)N(Cl)c2ccccc23)c1 |
| InChI | InChI=1S/C26H21Cl2NO2/c1-16-6-4-7-17(12-16)22-14-20(30)15-23(18-8-5-9-19(27)13-18)26(22)21-10-2-3-11-24(21)29(28)25(26)31/h2-13,22-23H,14-15H2,1H3 |
| InChIKey | VDBQLJNRZCFLNA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione?
The IUPAC name of 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione (CID 141220681) is 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione.
What is the SMILES notation for 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione?
The canonical SMILES for 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione is Cc1cccc(C2CC(=O)CC(c3cccc(Cl)c3)C23C(=O)N(Cl)c2ccccc23)c1.
What is the InChIKey of 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione?
The InChIKey is VDBQLJNRZCFLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21Cl2NO2/c1-16-6-4-7-17(12-16)22-14-20(30)15-23(18-8-5-9-19(27)13-18)26(22)21-10-2-3-11-24(21)29(28)25(26)31/h2-13,22-23H,14-15H2,1H3.
What are the key properties of 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione?
1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione has a molecular weight of 450.37 g/mol, XLogP of 6.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-chloro-3-(3-chlorophenyl)-5-(3-methylphenyl)spiro[cyclohexane-4,3'-indole]-1,2'-dione is sourced from PubChem (CID 141220681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).