C14H14N4O — CID 141220719
1-[(4-methoxyphenyl)methyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 141220719) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 141220719 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | COc1ccc(Cn2cnc3c(N)nccc32)cc1 |
| InChI | InChI=1S/C14H14N4O/c1-19-11-4-2-10(3-5-11)8-18-9-17-13-12(18)6-7-16-14(13)15/h2-7,9H,8H2,1H3,(H2,15,16) |
| InChIKey | FVTPLDYXGBAANN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |