C19H21NO3S — CID 141221061
4-[5-(furan-3-yl)-1H-indol-3-yl]-2,2-dimethylthiane 1,1-dioxide (PubChem CID 141221061) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-[5-(furan-3-yl)-1H-indol-3-yl]-2,2-dimethylthiane 1,1-dioxide.
| Compound Name | 4-[5-(furan-3-yl)-1H-indol-3-yl]-2,2-dimethylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 141221061 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[5-(furan-3-yl)-1H-indol-3-yl]-2,2-dimethylthiane 1,1-dioxide |
| SMILES | CC1(C)CC(c2c[nH]c3ccc(-c4ccoc4)cc23)CCS1(=O)=O |
| InChI | InChI=1S/C19H21NO3S/c1-19(2)10-14(6-8-24(19,21)22)17-11-20-18-4-3-13(9-16(17)18)15-5-7-23-12-15/h3-5,7,9,11-12,14,20H,6,8,10H2,1-2H3 |
| InChIKey | AAQNHGUMIJNGIJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |