C20H23N3O2S — CID 141221062
5-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylpyridin-2-amine (PubChem CID 141221062) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 5-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 141221062 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 5-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2ccc3[nH]cc(C4CCS(=O)(=O)CC4)c3c2)cn1 |
| InChI | InChI=1S/C20H23N3O2S/c1-23(2)20-6-4-16(12-22-20)15-3-5-19-17(11-15)18(13-21-19)14-7-9-26(24,25)10-8-14/h3-6,11-14,21H,7-10H2,1-2H3 |
| InChIKey | AKVDDVIVTXOYKZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |