About 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline
4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline (PubChem CID 141221099) has the molecular formula C21H24N2O2S
and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline |
| PubChem CID | 141221099 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2ccc3[nH]cc(C4CCS(=O)(=O)CC4)c3c2)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-23(2)18-6-3-15(4-7-18)17-5-8-21-19(13-17)20(14-22-21)16-9-11-26(24,25)12-10-16/h3-8,13-14,16,22H,9-12H2,1-2H3 |
| InChIKey | BFPYQWPNPSWFPE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline?
The IUPAC name of 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline (CID 141221099) is 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline?
The canonical SMILES for 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline is CN(C)c1ccc(-c2ccc3[nH]cc(C4CCS(=O)(=O)CC4)c3c2)cc1.
What is the InChIKey of 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline?
The InChIKey is BFPYQWPNPSWFPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2S/c1-23(2)18-6-3-15(4-7-18)17-5-8-21-19(13-17)20(14-22-21)16-9-11-26(24,25)12-10-16/h3-8,13-14,16,22H,9-12H2,1-2H3.
What are the key properties of 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline?
4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline has a molecular weight of 368.50 g/mol, XLogP of 4.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,1-dioxothian-4-yl)-1H-indol-5-yl]-N,N-dimethylaniline is sourced from PubChem (CID 141221099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).