C12H11F13 — CID 141221348
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-methylundec-2-ene (PubChem CID 141221348) has the molecular formula C12H11F13 and a molecular weight of 402.19 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-methylundec-2-ene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-methylundec-2-ene |
|---|---|
| PubChem CID | 141221348 |
| Molecular Formula | C12H11F13 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-methylundec-2-ene |
| SMILES | CC=C(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13/c1-3-6(2)4-5-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h3H,4-5H2,1-2H3 |
| InChIKey | GZHSKZSYMIEIMA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|