About 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine
1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine (PubChem CID 141222042) has the molecular formula C23H26ClFN4
and a molecular weight of 412.94 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine.
Molecular Properties
| Compound Name | 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine |
| PubChem CID | 141222042 |
| Molecular Formula | C23H26ClFN4 |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine |
| SMILES | CCCN1CN(Cc2ccc(Cl)cc2)C=C2C1=NC(CC)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26ClFN4/c1-3-13-28-16-27(14-17-5-7-18(24)8-6-17)15-21-23(28)26-22(4-2)29(21)20-11-9-19(25)10-12-20/h5-12,15,22H,3-4,13-14,16H2,1-2H3 |
| InChIKey | GQOJERXTIGHRAL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine?
The IUPAC name of 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine (CID 141222042) is 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine.
What is the SMILES notation for 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine?
The canonical SMILES for 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine is CCCN1CN(Cc2ccc(Cl)cc2)C=C2C1=NC(CC)N2c1ccc(F)cc1.
What is the InChIKey of 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine?
The InChIKey is GQOJERXTIGHRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26ClFN4/c1-3-13-28-16-27(14-17-5-7-18(24)8-6-17)15-21-23(28)26-22(4-2)29(21)20-11-9-19(25)10-12-20/h5-12,15,22H,3-4,13-14,16H2,1-2H3.
What are the key properties of 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine?
1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine has a molecular weight of 412.94 g/mol, XLogP of 5.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chlorophenyl)methyl]-8-ethyl-7-(4-fluorophenyl)-3-propyl-2,8-dihydropurine is sourced from PubChem (CID 141222042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).