C12H18N2O2 — CID 141222358
(3,5,6-trimethylpyrazin-2-yl)methyl 2-methylpropanoate (PubChem CID 141222358) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (3,5,6-trimethylpyrazin-2-yl)methyl 2-methylpropanoate.
| Compound Name | (3,5,6-trimethylpyrazin-2-yl)methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 141222358 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3,5,6-trimethylpyrazin-2-yl)methyl 2-methylpropanoate |
| SMILES | Cc1nc(C)c(COC(=O)C(C)C)nc1C |
| InChI | InChI=1S/C12H18N2O2/c1-7(2)12(15)16-6-11-10(5)13-8(3)9(4)14-11/h7H,6H2,1-5H3 |
| InChIKey | GUQZZRFTISBLTD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |