N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid

C9H21N2O4P — CID 141223404

IUPACN,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid
SMILESC=CCNCCCNCC=C.O=P(O)(O)O
InChIInChI=1S/C9H18N2.H3O4P/c1-3-6-10-8-5-9-11-7-4-2;1-5(2,3)4/h3-4,10-11H,1-2,5-9H2;(H3,1,2,3,4)
InChIKeyPTXJUJZGSUBMCZ-UHFFFAOYSA-N
MW252.25 g/mol
LogP-0.00
Rot. Bonds8

About N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid

N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid (PubChem CID 141223404) has the molecular formula C9H21N2O4P and a molecular weight of 252.25 g/mol. Its IUPAC name is N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid.

Molecular Properties

Compound NameN,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid
PubChem CID141223404
Molecular FormulaC9H21N2O4P
Molecular Weight252.25 g/mol
Exact Mass252.12
IUPAC NameN,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid
SMILESC=CCNCCCNCC=C.O=P(O)(O)O
InChIInChI=1S/C9H18N2.H3O4P/c1-3-6-10-8-5-9-11-7-4-2;1-5(2,3)4/h3-4,10-11H,1-2,5-9H2;(H3,1,2,3,4)
InChIKeyPTXJUJZGSUBMCZ-UHFFFAOYSA-N
XLogP-0.00
TPSA101.82 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.25
LogP ≤ 5-0.00
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
The IUPAC name of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid (CID 141223404) is N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid.
What is the SMILES notation for N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
The canonical SMILES for N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid is C=CCNCCCNCC=C.O=P(O)(O)O.
What is the InChIKey of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
The InChIKey is PTXJUJZGSUBMCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.H3O4P/c1-3-6-10-8-5-9-11-7-4-2;1-5(2,3)4/h3-4,10-11H,1-2,5-9H2;(H3,1,2,3,4).
What are the key properties of N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid?
N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid has a molecular weight of 252.25 g/mol, XLogP of -0.00, 8 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(prop-2-enyl)propane-1,3-diamine;phosphoric acid is sourced from PubChem (CID 141223404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).