About tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin
tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin (PubChem CID 141223505) has the molecular formula C16H24N2O2Sn
and a molecular weight of 395.09 g/mol. Its IUPAC name is tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin.
Molecular Properties
| Compound Name | tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin |
| PubChem CID | 141223505 |
| Molecular Formula | C16H24N2O2Sn |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin |
| SMILES | C[C@@H]1CN(c2cnc([Sn]C(C)(C)C)cc2C=O)C[C@H](C)O1 |
| InChI | InChI=1S/C12H15N2O2.C4H9.Sn/c1-9-6-14(7-10(2)16-9)12-5-13-4-3-11(12)8-15;1-4(2)3;/h3,5,8-10H,6-7H2,1-2H3;1-3H3;/t9-,10+;; |
| InChIKey | KVLDGKVBSYWDHM-BUQWBUBUSA-N |
| XLogP | 2.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin?
The IUPAC name of tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin (CID 141223505) is tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin.
What is the SMILES notation for tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin?
The canonical SMILES for tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin is C[C@@H]1CN(c2cnc([Sn]C(C)(C)C)cc2C=O)C[C@H](C)O1.
What is the InChIKey of tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin?
The InChIKey is KVLDGKVBSYWDHM-BUQWBUBUSA-N. The full InChI is InChI=1S/C12H15N2O2.C4H9.Sn/c1-9-6-14(7-10(2)16-9)12-5-13-4-3-11(12)8-15;1-4(2)3;/h3,5,8-10H,6-7H2,1-2H3;1-3H3;/t9-,10+;;.
What are the key properties of tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin?
tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin has a molecular weight of 395.09 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-formyl-2-pyridinyl]tin is sourced from PubChem (CID 141223505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).