About 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole
3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole (PubChem CID 141223533) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole.
Molecular Properties
| Compound Name | 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole |
| PubChem CID | 141223533 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole |
| SMILES | Cc1ccn(C2CCOC([C@@H]3CNC[C@H]3C)C2)n1 |
| InChI | InChI=1S/C14H23N3O/c1-10-8-15-9-13(10)14-7-12(4-6-18-14)17-5-3-11(2)16-17/h3,5,10,12-15H,4,6-9H2,1-2H3/t10-,12?,13-,14?/m1/s1 |
| InChIKey | OMEREZVSZNAJNB-AZVOEMOISA-N |
| XLogP | 1.77 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole?
The IUPAC name of 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole (CID 141223533) is 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole.
What is the SMILES notation for 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole?
The canonical SMILES for 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole is Cc1ccn(C2CCOC([C@@H]3CNC[C@H]3C)C2)n1.
What is the InChIKey of 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole?
The InChIKey is OMEREZVSZNAJNB-AZVOEMOISA-N. The full InChI is InChI=1S/C14H23N3O/c1-10-8-15-9-13(10)14-7-12(4-6-18-14)17-5-3-11(2)16-17/h3,5,10,12-15H,4,6-9H2,1-2H3/t10-,12?,13-,14?/m1/s1.
What are the key properties of 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole?
3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole has a molecular weight of 249.36 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[2-[(3S,4S)-4-methylpyrrolidin-3-yl]oxan-4-yl]pyrazole is sourced from PubChem (CID 141223533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).