About N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide
N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide (PubChem CID 141224692) has the molecular formula C15H13BrN2O4S2
and a molecular weight of 429.32 g/mol. Its IUPAC name is N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide |
| PubChem CID | 141224692 |
| Molecular Formula | C15H13BrN2O4S2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2cccs2)c1-c1onc(C)c1Br |
| InChI | InChI=1S/C15H13BrN2O4S2/c1-9-14(16)15(22-17-9)13-10(5-3-6-11(13)21-2)18-24(19,20)12-7-4-8-23-12/h3-8,18H,1-2H3 |
| InChIKey | CQZDPEJMYVPXLC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide?
The IUPAC name of N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide (CID 141224692) is N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide?
The canonical SMILES for N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide is COc1cccc(NS(=O)(=O)c2cccs2)c1-c1onc(C)c1Br.
What is the InChIKey of N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide?
The InChIKey is CQZDPEJMYVPXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2O4S2/c1-9-14(16)15(22-17-9)13-10(5-3-6-11(13)21-2)18-24(19,20)12-7-4-8-23-12/h3-8,18H,1-2H3.
What are the key properties of N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide?
N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide has a molecular weight of 429.32 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-methoxyphenyl]thiophene-2-sulfonamide is sourced from PubChem (CID 141224692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).