About trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin
trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin (PubChem CID 141225461) has the molecular formula C6H8Cl6Sn2
and a molecular weight of 530.27 g/mol. Its IUPAC name is trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin.
Molecular Properties
| Compound Name | trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin |
| PubChem CID | 141225461 |
| Molecular Formula | C6H8Cl6Sn2 |
| Molecular Weight | 530.27 g/mol |
| Exact Mass | 529.68 |
| IUPAC Name | trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin |
| SMILES | ClC(Cl)(Cl)[Sn]CCCC[Sn]C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8.2CCl3.2Sn/c1-3-4-2;2*2-1(3)4;;/h1-4H2;;;; |
| InChIKey | LQMCXPVSKOFFQC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin?
The IUPAC name of trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin (CID 141225461) is trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin.
What is the SMILES notation for trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin?
The canonical SMILES for trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin is ClC(Cl)(Cl)[Sn]CCCC[Sn]C(Cl)(Cl)Cl.
What is the InChIKey of trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin?
The InChIKey is LQMCXPVSKOFFQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.2CCl3.2Sn/c1-3-4-2;2*2-1(3)4;;/h1-4H2;;;;.
What are the key properties of trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin?
trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin has a molecular weight of 530.27 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloromethyl-[4-(trichloromethyl-λ2-stannanyl)butyl]tin is sourced from PubChem (CID 141225461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).