C25H29N3O — CID 141225487
1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-methyl-3-phenylquinoxalin-2-one (PubChem CID 141225487) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-methyl-3-phenylquinoxalin-2-one.
| Compound Name | 1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-methyl-3-phenylquinoxalin-2-one |
|---|---|
| PubChem CID | 141225487 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-methyl-3-phenylquinoxalin-2-one |
| SMILES | Cc1ccc2c(c1)nc(-c1ccccc1)c(=O)n2CC1CCCN2CCCCC12 |
| InChI | InChI=1S/C25H29N3O/c1-18-12-13-23-21(16-18)26-24(19-8-3-2-4-9-19)25(29)28(23)17-20-10-7-15-27-14-6-5-11-22(20)27/h2-4,8-9,12-13,16,20,22H,5-7,10-11,14-15,17H2,1H3 |
| InChIKey | XVLDXGOSDMFXHK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |