C21H30N4O3 — CID 141225630
[2-hydroxy-2-(methylamino)ethyl] N-[1-(1-isoquinolin-1-ylpiperidin-4-yl)propyl]carbamate (PubChem CID 141225630) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is [2-hydroxy-2-(methylamino)ethyl] N-[1-(1-isoquinolin-1-ylpiperidin-4-yl)propyl]carbamate.
| Compound Name | [2-hydroxy-2-(methylamino)ethyl] N-[1-(1-isoquinolin-1-ylpiperidin-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 141225630 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [2-hydroxy-2-(methylamino)ethyl] N-[1-(1-isoquinolin-1-ylpiperidin-4-yl)propyl]carbamate |
| SMILES | CCC(NC(=O)OCC(O)NC)C1CCN(c2nccc3ccccc23)CC1 |
| InChI | InChI=1S/C21H30N4O3/c1-3-18(24-21(27)28-14-19(26)22-2)16-9-12-25(13-10-16)20-17-7-5-4-6-15(17)8-11-23-20/h4-8,11,16,18-19,22,26H,3,9-10,12-14H2,1-2H3,(H,24,27) |
| InChIKey | BJTSLSINSNVUDZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|