About 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate
2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate (PubChem CID 141226433) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate |
| PubChem CID | 141226433 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1=CC(=O)N(C)C1=O |
| InChI | InChI=1S/C10H11NO4/c1-3-9(13)15-5-4-7-6-8(12)11(2)10(7)14/h3,6H,1,4-5H2,2H3 |
| InChIKey | HVKTVETUVDEPGW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate?
The IUPAC name of 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate (CID 141226433) is 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate.
What is the SMILES notation for 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate?
The canonical SMILES for 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate is C=CC(=O)OCCC1=CC(=O)N(C)C1=O.
What is the InChIKey of 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate?
The InChIKey is HVKTVETUVDEPGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-3-9(13)15-5-4-7-6-8(12)11(2)10(7)14/h3,6H,1,4-5H2,2H3.
What are the key properties of 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate?
2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate has a molecular weight of 209.20 g/mol, XLogP of 0.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-2,5-dioxopyrrol-3-yl)ethyl prop-2-enoate is sourced from PubChem (CID 141226433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).