C13H22O5S — CID 141226585
2-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)sulfonylbutane-1,1,1-triol (PubChem CID 141226585) has the molecular formula C13H22O5S and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)sulfonylbutane-1,1,1-triol.
| Compound Name | 2-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)sulfonylbutane-1,1,1-triol |
|---|---|
| PubChem CID | 141226585 |
| Molecular Formula | C13H22O5S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)sulfonylbutane-1,1,1-triol |
| SMILES | CCC(C(O)(O)O)S(=O)(=O)C1(C)C=CC(C)=CC1C |
| InChI | InChI=1S/C13H22O5S/c1-5-11(13(14,15)16)19(17,18)12(4)7-6-9(2)8-10(12)3/h6-8,10-11,14-16H,5H2,1-4H3 |
| InChIKey | MDGLRIYEMCSKEM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|