C20H22N2 — CID 141226760
cis-(1R,2R)-3,4-dibenzylidenecyclohexane-1,2-diamine (PubChem CID 141226760) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is cis-(1R,2R)-3,4-dibenzylidenecyclohexane-1,2-diamine.
| Compound Name | cis-(1R,2R)-3,4-dibenzylidenecyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 141226760 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | cis-(1R,2R)-3,4-dibenzylidenecyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCC(=Cc2ccccc2)C(=Cc2ccccc2)[C@H]1N |
| InChI | InChI=1S/C20H22N2/c21-19-12-11-17(13-15-7-3-1-4-8-15)18(20(19)22)14-16-9-5-2-6-10-16/h1-10,13-14,19-20H,11-12,21-22H2/t19-,20-/m1/s1 |
| InChIKey | ZAIGKUDGOMAYTB-WOJBJXKFSA-N |
| XLogP | 3.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |