C18H27NOS — CID 141226898
N-ethyl-2,2,3,3-tetramethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)cyclopropane-1-carboxamide (PubChem CID 141226898) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)cyclopropane-1-carboxamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 141226898 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)cyclopropane-1-carboxamide |
| SMILES | CCN(C(=O)C1C(C)(C)C1(C)C)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H27NOS/c1-6-19(16(20)15-17(2,3)18(15,4)5)14-11-12-9-7-8-10-13(12)21-14/h11,15H,6-10H2,1-5H3 |
| InChIKey | ABLOXPJEQZIBGP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |