C23H20ClFN4O6 — CID 141227203
methyl 7-chloro-2-[(7-fluoro-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)carbamoyl]-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a-carboxylate (PubChem CID 141227203) has the molecular formula C23H20ClFN4O6 and a molecular weight of 502.89 g/mol. Its IUPAC name is methyl 7-chloro-2-[(7-fluoro-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)carbamoyl]-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a-carboxylate.
| Compound Name | methyl 7-chloro-2-[(7-fluoro-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)carbamoyl]-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a-carboxylate |
|---|---|
| PubChem CID | 141227203 |
| Molecular Formula | C23H20ClFN4O6 |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | methyl 7-chloro-2-[(7-fluoro-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)carbamoyl]-3,5-dihydroindeno[1,2-e][1,3,4]oxadiazine-4a-carboxylate |
| SMILES | COC(=O)C12Cc3cc(Cl)ccc3C1=NN(C(=O)Nc1cc3c(cc1F)OC(C)C(=O)N3C)CO2 |
| InChI | InChI=1S/C23H20ClFN4O6/c1-11-20(30)28(2)17-8-16(15(25)7-18(17)35-11)26-22(32)29-10-34-23(21(31)33-3)9-12-6-13(24)4-5-14(12)19(23)27-29/h4-8,11H,9-10H2,1-3H3,(H,26,32) |
| InChIKey | JIDSFOICFKIMBM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |