C22H26ClNO7 — CID 141227286
6,7-dimethoxy-3-(5,6,7-trimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3H-2-benzofuran-1-one;hydrochloride (PubChem CID 141227286) has the molecular formula C22H26ClNO7 and a molecular weight of 451.90 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(5,6,7-trimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3H-2-benzofuran-1-one;hydrochloride.
| Compound Name | 6,7-dimethoxy-3-(5,6,7-trimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3H-2-benzofuran-1-one;hydrochloride |
|---|---|
| PubChem CID | 141227286 |
| Molecular Formula | C22H26ClNO7 |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 6,7-dimethoxy-3-(5,6,7-trimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3H-2-benzofuran-1-one;hydrochloride |
| SMILES | COc1cc2c(c(OC)c1OC)CCNC2C1OC(=O)c2c1ccc(OC)c2OC.Cl |
| InChI | InChI=1S/C22H25NO7.ClH/c1-25-14-7-6-12-16(20(14)28-4)22(24)30-18(12)17-13-10-15(26-2)21(29-5)19(27-3)11(13)8-9-23-17;/h6-7,10,17-18,23H,8-9H2,1-5H3;1H |
| InChIKey | YBVRLSNCGPKNMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |