About 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine
8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine (PubChem CID 141227735) has the molecular formula C20H20N2O
and a molecular weight of 304.39 g/mol. Its IUPAC name is 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine.
Molecular Properties
| Compound Name | 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine |
| PubChem CID | 141227735 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine |
| SMILES | C=Cc1ccc2c(c1)c(O[C@H]1CN[C@@H](C)C1)nc1ccccc12 |
| InChI | InChI=1S/C20H20N2O/c1-3-14-8-9-16-17-6-4-5-7-19(17)22-20(18(16)11-14)23-15-10-13(2)21-12-15/h3-9,11,13,15,21H,1,10,12H2,2H3/t13-,15+/m0/s1 |
| InChIKey | KNYPWUNTWNIAGI-DZGCQCFKSA-N |
| XLogP | 4.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine?
The IUPAC name of 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine (CID 141227735) is 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine.
What is the SMILES notation for 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine?
The canonical SMILES for 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine is C=Cc1ccc2c(c1)c(O[C@H]1CN[C@@H](C)C1)nc1ccccc12.
What is the InChIKey of 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine?
The InChIKey is KNYPWUNTWNIAGI-DZGCQCFKSA-N. The full InChI is InChI=1S/C20H20N2O/c1-3-14-8-9-16-17-6-4-5-7-19(17)22-20(18(16)11-14)23-15-10-13(2)21-12-15/h3-9,11,13,15,21H,1,10,12H2,2H3/t13-,15+/m0/s1.
What are the key properties of 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine?
8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine has a molecular weight of 304.39 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethenyl-6-[(3R,5S)-5-methylpyrrolidin-3-yl]oxyphenanthridine is sourced from PubChem (CID 141227735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).