C17H21F2N3OS — CID 141227975
N-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2,5-difluoro-N'-methoxybenzenecarboximidamide (PubChem CID 141227975) has the molecular formula C17H21F2N3OS and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2,5-difluoro-N'-methoxybenzenecarboximidamide.
| Compound Name | N-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2,5-difluoro-N'-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 141227975 |
| Molecular Formula | C17H21F2N3OS |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2,5-difluoro-N'-methoxybenzenecarboximidamide |
| SMILES | CCCCn1c(C)c(C)s/c1=N\C(=N/OC)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H21F2N3OS/c1-5-6-9-22-11(2)12(3)24-17(22)20-16(21-23-4)14-10-13(18)7-8-15(14)19/h7-8,10H,5-6,9H2,1-4H3/b20-17-,21-16- |
| InChIKey | ZZZFCHKDENCGBI-CEUKJHGTSA-N |
| XLogP | 4.15 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|