C21H18N2O4 — CID 141228014
(2S,3R)-2-[N-formyl-4-(4-phenylbuta-1,3-diynyl)anilino]-N,3-dihydroxybutanamide (PubChem CID 141228014) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is (2S,3R)-2-[N-formyl-4-(4-phenylbuta-1,3-diynyl)anilino]-N,3-dihydroxybutanamide.
| Compound Name | (2S,3R)-2-[N-formyl-4-(4-phenylbuta-1,3-diynyl)anilino]-N,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 141228014 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2S,3R)-2-[N-formyl-4-(4-phenylbuta-1,3-diynyl)anilino]-N,3-dihydroxybutanamide |
| SMILES | C[C@@H](O)[C@@H](C(=O)NO)N(C=O)c1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O4/c1-16(25)20(21(26)22-27)23(15-24)19-13-11-18(12-14-19)10-6-5-9-17-7-3-2-4-8-17/h2-4,7-8,11-16,20,25,27H,1H3,(H,22,26)/t16-,20+/m1/s1 |
| InChIKey | DCAZKSOMSSTVBC-UZLBHIALSA-N |
| XLogP | 1.31 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|