About 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde
4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 141228189) has the molecular formula C7H6ClNO4
and a molecular weight of 203.58 g/mol. Its IUPAC name is 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 141228189 |
| Molecular Formula | C7H6ClNO4 |
| Molecular Weight | 203.58 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C=CC(Cl)=CC1(O)[N+](=O)[O-] |
| InChI | InChI=1S/C7H6ClNO4/c8-6-2-1-5(4-10)7(11,3-6)9(12)13/h1-5,11H |
| InChIKey | XIFBQFCRLXBKRP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.58 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde (CID 141228189) is 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde is O=CC1C=CC(Cl)=CC1(O)[N+](=O)[O-].
What is the InChIKey of 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is XIFBQFCRLXBKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO4/c8-6-2-1-5(4-10)7(11,3-6)9(12)13/h1-5,11H.
What are the key properties of 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde?
4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 203.58 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-hydroxy-6-nitrocyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 141228189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).