About 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one
3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one (PubChem CID 141228564) has the molecular formula C12H12FNO3
and a molecular weight of 237.23 g/mol. Its IUPAC name is 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one |
| PubChem CID | 141228564 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one |
| SMILES | COc1cc2[nH]c(=O)c(F)c(C)c2cc1OC |
| InChI | InChI=1S/C12H12FNO3/c1-6-7-4-9(16-2)10(17-3)5-8(7)14-12(15)11(6)13/h4-5H,1-3H3,(H,14,15) |
| InChIKey | JLOXZUWVSOJUBW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one?
The IUPAC name of 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one (CID 141228564) is 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one.
What is the SMILES notation for 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one?
The canonical SMILES for 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one is COc1cc2[nH]c(=O)c(F)c(C)c2cc1OC.
What is the InChIKey of 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one?
The InChIKey is JLOXZUWVSOJUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO3/c1-6-7-4-9(16-2)10(17-3)5-8(7)14-12(15)11(6)13/h4-5H,1-3H3,(H,14,15).
What are the key properties of 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one?
3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one has a molecular weight of 237.23 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6,7-dimethoxy-4-methyl-1H-quinolin-2-one is sourced from PubChem (CID 141228564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).