About N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine
N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine (PubChem CID 14122863) has the molecular formula C9H23N3
and a molecular weight of 173.30 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine |
| PubChem CID | 14122863 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CCCN)CCCN |
| InChI | InChI=1S/C9H23N3/c1-2-7-12(8-3-5-10)9-4-6-11/h2-11H2,1H3 |
| InChIKey | CSIOOUSJMRKIAQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine?
The IUPAC name of N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine (CID 14122863) is N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine?
The canonical SMILES for N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine is CCCN(CCCN)CCCN.
What is the InChIKey of N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine?
The InChIKey is CSIOOUSJMRKIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23N3/c1-2-7-12(8-3-5-10)9-4-6-11/h2-11H2,1H3.
What are the key properties of N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine?
N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine has a molecular weight of 173.30 g/mol, XLogP of 0.40, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-aminopropyl)-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 14122863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).