About bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate
bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate (PubChem CID 141229285) has the molecular formula C36H63AlO12
and a molecular weight of 714.87 g/mol. Its IUPAC name is bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate.
Molecular Properties
| Compound Name | bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate |
| PubChem CID | 141229285 |
| Molecular Formula | C36H63AlO12 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate |
| SMILES | CCCCOCC(=O)C(CC)(CC)C(=O)O[Al](OC(=O)C(CC)(CC)C(=O)COCCCC)OC(=O)C(CC)(CC)C(=O)COCCCC |
| InChI | InChI=1S/3C12H22O4.Al/c3*1-4-7-8-16-9-10(13)12(5-2,6-3)11(14)15;/h3*4-9H2,1-3H3,(H,14,15);/q;;;+3/p-3 |
| InChIKey | TYLOZNBISKCXJQ-UHFFFAOYSA-K |
| XLogP | 6.18 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate?
The IUPAC name of bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate (CID 141229285) is bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate.
What is the SMILES notation for bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate?
The canonical SMILES for bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate is CCCCOCC(=O)C(CC)(CC)C(=O)O[Al](OC(=O)C(CC)(CC)C(=O)COCCCC)OC(=O)C(CC)(CC)C(=O)COCCCC.
What is the InChIKey of bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate?
The InChIKey is TYLOZNBISKCXJQ-UHFFFAOYSA-K. The full InChI is InChI=1S/3C12H22O4.Al/c3*1-4-7-8-16-9-10(13)12(5-2,6-3)11(14)15;/h3*4-9H2,1-3H3,(H,14,15);/q;;;+3/p-3.
What are the key properties of bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate?
bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate has a molecular weight of 714.87 g/mol, XLogP of 6.18, 30 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(4-butoxy-2,2-diethyl-3-oxobutanoyl)oxy]alumanyl 4-butoxy-2,2-diethyl-3-oxobutanoate is sourced from PubChem (CID 141229285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).