C24H20N2O2 — CID 141229376
2-[3-[3-(2-pyridin-4-ylethynyl)phenyl]propyl]-3a,4-dihydroisoindole-1,3-dione (PubChem CID 141229376) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[3-[3-(2-pyridin-4-ylethynyl)phenyl]propyl]-3a,4-dihydroisoindole-1,3-dione.
| Compound Name | 2-[3-[3-(2-pyridin-4-ylethynyl)phenyl]propyl]-3a,4-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 141229376 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[3-[3-(2-pyridin-4-ylethynyl)phenyl]propyl]-3a,4-dihydroisoindole-1,3-dione |
| SMILES | O=C1C2=CC=CCC2C(=O)N1CCCc1cccc(C#Cc2ccncc2)c1 |
| InChI | InChI=1S/C24H20N2O2/c27-23-21-8-1-2-9-22(21)24(28)26(23)16-4-7-19-5-3-6-20(17-19)11-10-18-12-14-25-15-13-18/h1-3,5-6,8,12-15,17,22H,4,7,9,16H2 |
| InChIKey | RXCLPNRSDSSXAF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|