About N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride
N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride (PubChem CID 141229442) has the molecular formula C4H3ClN2O3S2
and a molecular weight of 226.67 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride.
Molecular Properties
| Compound Name | N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride |
| PubChem CID | 141229442 |
| Molecular Formula | C4H3ClN2O3S2 |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 225.93 |
| IUPAC Name | N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride |
| SMILES | O=C(Cl)NS(=O)(=O)c1cncs1 |
| InChI | InChI=1S/C4H3ClN2O3S2/c5-4(8)7-12(9,10)3-1-6-2-11-3/h1-2H,(H,7,8) |
| InChIKey | MAWPDAWZVHQGLP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride?
The IUPAC name of N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride (CID 141229442) is N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride.
What is the SMILES notation for N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride?
The canonical SMILES for N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride is O=C(Cl)NS(=O)(=O)c1cncs1.
What is the InChIKey of N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride?
The InChIKey is MAWPDAWZVHQGLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClN2O3S2/c5-4(8)7-12(9,10)3-1-6-2-11-3/h1-2H,(H,7,8).
What are the key properties of N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride?
N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride has a molecular weight of 226.67 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-thiazol-5-ylsulfonyl)carbamoyl chloride is sourced from PubChem (CID 141229442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).