C9H5F5O2 — CID 14122983
(2,3,4,5,6-pentafluorophenyl)methyl acetate (PubChem CID 14122983) has the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl acetate |
|---|---|
| PubChem CID | 14122983 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl acetate |
| SMILES | CC(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5O2/c1-3(15)16-2-4-5(10)7(12)9(14)8(13)6(4)11/h2H2,1H3 |
| InChIKey | BKWSXTXKQABCID-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|