4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid

C12H16N2O4 — CID 141229873

IUPAC4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid
SMILESCc1nc(C)c(COC(=O)CCC(=O)O)nc1C
InChIInChI=1S/C12H16N2O4/c1-7-8(2)14-10(9(3)13-7)6-18-12(17)5-4-11(15)16/h4-6H2,1-3H3,(H,15,16)
InChIKeyHBSLNKMEGMICFK-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.31
Rot. Bonds5

About 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid

4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid (PubChem CID 141229873) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid.

Molecular Properties

Compound Name4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid
PubChem CID141229873
Molecular FormulaC12H16N2O4
Molecular Weight252.27 g/mol
Exact Mass252.11
IUPAC Name4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid
SMILESCc1nc(C)c(COC(=O)CCC(=O)O)nc1C
InChIInChI=1S/C12H16N2O4/c1-7-8(2)14-10(9(3)13-7)6-18-12(17)5-4-11(15)16/h4-6H2,1-3H3,(H,15,16)
InChIKeyHBSLNKMEGMICFK-UHFFFAOYSA-N
XLogP1.31
TPSA89.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid?
The IUPAC name of 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid (CID 141229873) is 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid.
What is the SMILES notation for 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid?
The canonical SMILES for 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid is Cc1nc(C)c(COC(=O)CCC(=O)O)nc1C.
What is the InChIKey of 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid?
The InChIKey is HBSLNKMEGMICFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-7-8(2)14-10(9(3)13-7)6-18-12(17)5-4-11(15)16/h4-6H2,1-3H3,(H,15,16).
What are the key properties of 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid?
4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid has a molecular weight of 252.27 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-[(3,5,6-trimethylpyrazin-2-yl)methoxy]butanoic acid is sourced from PubChem (CID 141229873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).