C12H18O6 — CID 141230719
(3aR,4R,6R,6aR)-6-(2,2-dimethyl-1,3-dioxol-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol (PubChem CID 141230719) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-6-(2,2-dimethyl-1,3-dioxol-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4R,6R,6aR)-6-(2,2-dimethyl-1,3-dioxol-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 141230719 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3aR,4R,6R,6aR)-6-(2,2-dimethyl-1,3-dioxol-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1(C)OC=C([C@@H]2O[C@@H](O)[C@@H]3OC(C)(C)O[C@@H]32)O1 |
| InChI | InChI=1S/C12H18O6/c1-11(2)14-5-6(16-11)7-8-9(10(13)15-7)18-12(3,4)17-8/h5,7-10,13H,1-4H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | VPVCNRQMCZNPEW-SGIHWFKDSA-N |
| XLogP | 0.85 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |