C21H19Cl3FN7OS2 — CID 141230738
4-[4-(3-cyclopropyl-3-fluoroazetidin-1-yl)-6-(1,2,4-thiadiazol-5-ylamino)pyrimidin-2-yl]sulfanyl-N-(2,2,2-trichloroethyl)benzamide (PubChem CID 141230738) has the molecular formula C21H19Cl3FN7OS2 and a molecular weight of 574.92 g/mol. Its IUPAC name is 4-[4-(3-cyclopropyl-3-fluoroazetidin-1-yl)-6-(1,2,4-thiadiazol-5-ylamino)pyrimidin-2-yl]sulfanyl-N-(2,2,2-trichloroethyl)benzamide.
| Compound Name | 4-[4-(3-cyclopropyl-3-fluoroazetidin-1-yl)-6-(1,2,4-thiadiazol-5-ylamino)pyrimidin-2-yl]sulfanyl-N-(2,2,2-trichloroethyl)benzamide |
|---|---|
| PubChem CID | 141230738 |
| Molecular Formula | C21H19Cl3FN7OS2 |
| Molecular Weight | 574.92 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | 4-[4-(3-cyclopropyl-3-fluoroazetidin-1-yl)-6-(1,2,4-thiadiazol-5-ylamino)pyrimidin-2-yl]sulfanyl-N-(2,2,2-trichloroethyl)benzamide |
| SMILES | O=C(NCC(Cl)(Cl)Cl)c1ccc(Sc2nc(Nc3ncns3)cc(N3CC(F)(C4CC4)C3)n2)cc1 |
| InChI | InChI=1S/C21H19Cl3FN7OS2/c22-21(23,24)8-26-17(33)12-1-5-14(6-2-12)34-19-30-15(29-18-27-11-28-35-18)7-16(31-19)32-9-20(25,10-32)13-3-4-13/h1-2,5-7,11,13H,3-4,8-10H2,(H,26,33)(H,27,28,29,30,31) |
| InChIKey | YDIALKMSOZERNL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|