About 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one
6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 141230749) has the molecular formula C6H5FO2
and a molecular weight of 128.10 g/mol. Its IUPAC name is 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one |
| PubChem CID | 141230749 |
| Molecular Formula | C6H5FO2 |
| Molecular Weight | 128.10 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1(O)F |
| InChI | InChI=1S/C6H5FO2/c7-6(9)4-2-1-3-5(6)8/h1-4,9H |
| InChIKey | LGEICTZYPBJRAG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.10 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one?
The IUPAC name of 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one (CID 141230749) is 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one is O=C1C=CC=CC1(O)F.
What is the InChIKey of 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one?
The InChIKey is LGEICTZYPBJRAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO2/c7-6(9)4-2-1-3-5(6)8/h1-4,9H.
What are the key properties of 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one?
6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one has a molecular weight of 128.10 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-6-hydroxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 141230749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).