C13H9N3O4S — CID 141230790
2-(5-methyl-7-nitro-1H-indol-2-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 141230790) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-(5-methyl-7-nitro-1H-indol-2-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(5-methyl-7-nitro-1H-indol-2-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 141230790 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(5-methyl-7-nitro-1H-indol-2-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc([N+](=O)[O-])c2[nH]c(-c3nc(C(=O)O)cs3)cc2c1 |
| InChI | InChI=1S/C13H9N3O4S/c1-6-2-7-4-8(12-15-9(5-21-12)13(17)18)14-11(7)10(3-6)16(19)20/h2-5,14H,1H3,(H,17,18) |
| InChIKey | VPMOWOGWYKFTRY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|