C33H35ClN4O6S — CID 141230871
2-[6-[(3S)-3-methylmorpholin-4-yl]-2-[4-(phenoxycarbonylamino)phenyl]pyrimidin-4-yl]pentan-2-yl 4-chlorobenzenesulfonate (PubChem CID 141230871) has the molecular formula C33H35ClN4O6S and a molecular weight of 651.19 g/mol. Its IUPAC name is 2-[6-[(3S)-3-methylmorpholin-4-yl]-2-[4-(phenoxycarbonylamino)phenyl]pyrimidin-4-yl]pentan-2-yl 4-chlorobenzenesulfonate.
| Compound Name | 2-[6-[(3S)-3-methylmorpholin-4-yl]-2-[4-(phenoxycarbonylamino)phenyl]pyrimidin-4-yl]pentan-2-yl 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 141230871 |
| Molecular Formula | C33H35ClN4O6S |
| Molecular Weight | 651.19 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 2-[6-[(3S)-3-methylmorpholin-4-yl]-2-[4-(phenoxycarbonylamino)phenyl]pyrimidin-4-yl]pentan-2-yl 4-chlorobenzenesulfonate |
| SMILES | CCCC(C)(OS(=O)(=O)c1ccc(Cl)cc1)c1cc(N2CCOC[C@@H]2C)nc(-c2ccc(NC(=O)Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C33H35ClN4O6S/c1-4-18-33(3,44-45(40,41)28-16-12-25(34)13-17-28)29-21-30(38-19-20-42-22-23(38)2)37-31(36-29)24-10-14-26(15-11-24)35-32(39)43-27-8-6-5-7-9-27/h5-17,21,23H,4,18-20,22H2,1-3H3,(H,35,39)/t23-,33?/m0/s1 |
| InChIKey | SAIWTKVHUQTBTF-SBYCOZGSSA-N |
| XLogP | 7.05 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.19 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|