About (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate
(2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate (PubChem CID 141231482) has the molecular formula C14H14N6O2
and a molecular weight of 298.31 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate |
| PubChem CID | 141231482 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate |
| SMILES | CCn1nccc1OC(=O)c1ccc(-n2cncn2)nc1C |
| InChI | InChI=1S/C14H14N6O2/c1-3-19-13(6-7-16-19)22-14(21)11-4-5-12(18-10(11)2)20-9-15-8-17-20/h4-9H,3H2,1-2H3 |
| InChIKey | NYSGIGCZQJFAIC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate?
The IUPAC name of (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate (CID 141231482) is (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate.
What is the SMILES notation for (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate?
The canonical SMILES for (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate is CCn1nccc1OC(=O)c1ccc(-n2cncn2)nc1C.
What is the InChIKey of (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate?
The InChIKey is NYSGIGCZQJFAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6O2/c1-3-19-13(6-7-16-19)22-14(21)11-4-5-12(18-10(11)2)20-9-15-8-17-20/h4-9H,3H2,1-2H3.
What are the key properties of (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate?
(2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate has a molecular weight of 298.31 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylpyrazol-3-yl) 2-methyl-6-(1,2,4-triazol-1-yl)pyridine-3-carboxylate is sourced from PubChem (CID 141231482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).