C17H32O4Si — CID 141231502
(Z)-4-[2-methylhexan-2-yl-di(propan-2-yl)silyl]oxy-4-oxobut-2-enoic acid (PubChem CID 141231502) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (Z)-4-[2-methylhexan-2-yl-di(propan-2-yl)silyl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-methylhexan-2-yl-di(propan-2-yl)silyl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 141231502 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (Z)-4-[2-methylhexan-2-yl-di(propan-2-yl)silyl]oxy-4-oxobut-2-enoic acid |
| SMILES | CCCCC(C)(C)[Si](OC(=O)/C=C\C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-8-9-12-17(6,7)22(13(2)3,14(4)5)21-16(20)11-10-15(18)19/h10-11,13-14H,8-9,12H2,1-7H3,(H,18,19)/b11-10- |
| InChIKey | XIHCASWYEMCFFF-KHPPLWFESA-N |
| XLogP | 4.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|