C6H7O10SSb — CID 141231740
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-[(2,2-dioxo-1,3,2,4-dioxathiastibetan-4-yl)oxy]-4-hydroxy-2H-furan-5-one (PubChem CID 141231740) has the molecular formula C6H7O10SSb and a molecular weight of 392.94 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-[(2,2-dioxo-1,3,2,4-dioxathiastibetan-4-yl)oxy]-4-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-[(2,2-dioxo-1,3,2,4-dioxathiastibetan-4-yl)oxy]-4-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 141231740 |
| Molecular Formula | C6H7O10SSb |
| Molecular Weight | 392.94 g/mol |
| Exact Mass | 391.88 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-[(2,2-dioxo-1,3,2,4-dioxathiastibetan-4-yl)oxy]-4-hydroxy-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O[Sb]2OS(=O)(=O)O2)=C1O |
| InChI | InChI=1S/C6H8O6.H2O4S.Sb/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-5(2,3)4;/h2,5,7-10H,1H2;(H2,1,2,3,4);/q;;+3/p-3/t2-,5+;;/m0../s1 |
| InChIKey | SSSRCFYCVLMGKZ-PQYRJTSOSA-K |
| XLogP | -2.67 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.94 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|