C21H34O4 — CID 141232442
bis(2-methylpropyl) 2,3,5,6-tetramethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 141232442) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,3,5,6-tetramethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 2,3,5,6-tetramethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 141232442 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | bis(2-methylpropyl) 2,3,5,6-tetramethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC1=C(C)C2CC1C(C)(C(=O)OCC(C)C)C2(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C21H34O4/c1-12(2)10-24-18(22)20(7)16-9-17(15(6)14(16)5)21(20,8)19(23)25-11-13(3)4/h12-13,16-17H,9-11H2,1-8H3 |
| InChIKey | ZNAIZYNINCMJDW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|