About 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone
2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone (PubChem CID 141233001) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone |
| PubChem CID | 141233001 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone |
| SMILES | COc1cc2c(cc1N)N(CC(=O)N1CCCC1)CCC2(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-18(2)6-9-21(12-17(22)20-7-4-5-8-20)15-11-14(19)16(23-3)10-13(15)18/h10-11H,4-9,12,19H2,1-3H3 |
| InChIKey | WJUFHUAKTKSBAD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone?
The IUPAC name of 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone (CID 141233001) is 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone.
What is the SMILES notation for 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone?
The canonical SMILES for 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone is COc1cc2c(cc1N)N(CC(=O)N1CCCC1)CCC2(C)C.
What is the InChIKey of 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone?
The InChIKey is WJUFHUAKTKSBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-18(2)6-9-21(12-17(22)20-7-4-5-8-20)15-11-14(19)16(23-3)10-13(15)18/h10-11H,4-9,12,19H2,1-3H3.
What are the key properties of 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone?
2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone has a molecular weight of 317.43 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-amino-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)-1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 141233001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).