C16H32N2O — CID 141233322
2,2,5,5-tetramethyl-1-(2,2,5,5-tetramethylpyrrolidin-1-yl)oxypyrrolidine (PubChem CID 141233322) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1-(2,2,5,5-tetramethylpyrrolidin-1-yl)oxypyrrolidine.
| Compound Name | 2,2,5,5-tetramethyl-1-(2,2,5,5-tetramethylpyrrolidin-1-yl)oxypyrrolidine |
|---|---|
| PubChem CID | 141233322 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 2,2,5,5-tetramethyl-1-(2,2,5,5-tetramethylpyrrolidin-1-yl)oxypyrrolidine |
| SMILES | CC1(C)CCC(C)(C)N1ON1C(C)(C)CCC1(C)C |
| InChI | InChI=1S/C16H32N2O/c1-13(2)9-10-14(3,4)17(13)19-18-15(5,6)11-12-16(18,7)8/h9-12H2,1-8H3 |
| InChIKey | PQUKDRGVFHLYCH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |