C18H16ClN5O — CID 141233413
1-(2-methyl-1H-indol-6-yl)-3-(1,5-naphthyridin-4-yl)urea;hydrochloride (PubChem CID 141233413) has the molecular formula C18H16ClN5O and a molecular weight of 353.81 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-6-yl)-3-(1,5-naphthyridin-4-yl)urea;hydrochloride.
| Compound Name | 1-(2-methyl-1H-indol-6-yl)-3-(1,5-naphthyridin-4-yl)urea;hydrochloride |
|---|---|
| PubChem CID | 141233413 |
| Molecular Formula | C18H16ClN5O |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-(2-methyl-1H-indol-6-yl)-3-(1,5-naphthyridin-4-yl)urea;hydrochloride |
| SMILES | Cc1cc2ccc(NC(=O)Nc3ccnc4cccnc34)cc2[nH]1.Cl |
| InChI | InChI=1S/C18H15N5O.ClH/c1-11-9-12-4-5-13(10-16(12)21-11)22-18(24)23-15-6-8-19-14-3-2-7-20-17(14)15;/h2-10,21H,1H3,(H2,19,22,23,24);1H |
| InChIKey | SRHBAYNWIPYKTD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |