C27H39FN2O4S — CID 141233529
(3S,4S,5R)-3-[(4-amino-3-butyl-5-fluorophenyl)methyl]-5-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 141233529) has the molecular formula C27H39FN2O4S and a molecular weight of 506.68 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(4-amino-3-butyl-5-fluorophenyl)methyl]-5-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[(4-amino-3-butyl-5-fluorophenyl)methyl]-5-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 141233529 |
| Molecular Formula | C27H39FN2O4S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (3S,4S,5R)-3-[(4-amino-3-butyl-5-fluorophenyl)methyl]-5-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CCCCc1cc(C[C@@H]2CS(=O)(=O)C[C@H](NCc3cccc(C(C)(C)C)c3O)[C@H]2O)cc(F)c1N |
| InChI | InChI=1S/C27H39FN2O4S/c1-5-6-8-18-11-17(13-22(28)24(18)29)12-20-15-35(33,34)16-23(26(20)32)30-14-19-9-7-10-21(25(19)31)27(2,3)4/h7,9-11,13,20,23,26,30-32H,5-6,8,12,14-16,29H2,1-4H3/t20-,23+,26+/m1/s1 |
| InChIKey | YHGLEKYHEXJAEI-SEIBCYHCSA-N |
| XLogP | 3.86 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|