C17H26O8 — CID 141233879
[(1R)-1-[(2S)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-1,2-dihydroxyethyl] (E)-undec-2-enoate (PubChem CID 141233879) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is [(1R)-1-[(2S)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-1,2-dihydroxyethyl] (E)-undec-2-enoate.
| Compound Name | [(1R)-1-[(2S)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-1,2-dihydroxyethyl] (E)-undec-2-enoate |
|---|---|
| PubChem CID | 141233879 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [(1R)-1-[(2S)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-1,2-dihydroxyethyl] (E)-undec-2-enoate |
| SMILES | CCCCCCCC/C=C/C(=O)O[C@](O)(CO)[C@H]1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C17H26O8/c1-2-3-4-5-6-7-8-9-10-12(19)25-17(23,11-18)15-13(20)14(21)16(22)24-15/h9-10,15,18,20-21,23H,2-8,11H2,1H3/b10-9+/t15-,17+/m0/s1 |
| InChIKey | ZLDFEXZTTAPZNK-ZMMKQQPBSA-N |
| XLogP | 1.77 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|